CAS 74270-76-1

4-(4-chlorophenyl)-5-(pyridin-4-yl)-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-(4-Chlorophenyl)-5-(pyridin-4-yl)-2,4-dihydro-3H-1,2,4-triazole-3-thione, identified by its CAS number 74270-76-1, is a heterocyclic compound featuring a triazole ring, which is characterized by its three nitrogen atoms and two carbon atoms. This compound exhibits thione functionality, indicating the presence of a sulfur atom double-bonded to a carbon atom within the triazole structure. The presence of a 4-chlorophenyl group and a pyridin-4-yl group contributes to its potential biological activity and lipophilicity, making it of interest in medicinal chemistry. The compound may exhibit various pharmacological properties, including antimicrobial or antifungal activities, due to the structural motifs it contains. Its solubility and stability can vary based on environmental conditions, such as pH and temperature. Additionally, the presence of halogen and nitrogen-containing groups may influence its reactivity and interactions with biological targets. Overall, this compound represents a class of triazole derivatives that are often explored for their therapeutic potential.

Formula: C₁₃H₉ClN₄S

InChI: InChI=1/C13H9ClN4S/c14-10-1-3-11(4-2-10)18-12(16-17-13(18)19)9-5-7-15-8-6-9/h1-8H,(H,17,19)

SMILES: c1cc(ccc1Cl)n1c(c2ccncc2)nnc1S

Synonyms:

• 4H-1,2,4-triazole-3-thiol, 4-(4-chlorophenyl)-5-(4-pyridinyl)-

4-(4-Chlorophenyl)-5-(pyridin-4-yl)-4H-1,2,4-triazole-3-thiol

CAS: 74270-76-1

Versatile small molecule scaffold

Formula: C₁₃H₉ClN₄S

Purity: Min. 95%

Molecular weight: 288.76 g/mol

Ref: 3D-ZCA27076