CAS 74276-54-3

[1,1′-Biphenyl]-3,4′,5-triol

Description:

[1,1′-Biphenyl]-3,4′,5-triol, also known as 3,4′,5-trihydroxybiphenyl, is an organic compound characterized by the presence of two phenyl rings connected by a single bond, with three hydroxyl (-OH) groups attached to the biphenyl structure. This compound exhibits properties typical of polyphenolic compounds, including potential antioxidant activity due to the presence of multiple hydroxyl groups, which can donate hydrogen atoms and scavenge free radicals. Its molecular structure contributes to its solubility in polar solvents, while its aromatic nature may influence its interactions with biological systems. The compound may also participate in various chemical reactions, such as oxidation or complexation with metal ions. Additionally, [1,1′-Biphenyl]-3,4′,5-triol may have applications in fields such as materials science, pharmaceuticals, and biochemistry, particularly in studies related to its biological activity and potential therapeutic effects. However, specific safety and handling guidelines should be followed, as with any chemical substance.

Formula: C₁₂H₁₀O₃

InChI: InChI=1S/C12H10O3/c13-10-3-1-8(2-4-10)9-5-11(14)7-12(15)6-9/h1-7,13-15H

InChI key: InChIKey=HSZOQEGJICWJDP-UHFFFAOYSA-N

SMILES: OC=1C=C(C=C(O)C1)C2=CC=C(O)C=C2

Synonyms:

• 4-(3,5-Dihydroxyphenyl)-phenol
• 3,4′,5-Trihydroxybiphenyl
• [1,1′-Biphenyl]-3,4′,5-triol