CAS 7429-40-5
:rel-(1R,2R)-2-Methoxycyclohexanol
Description:
Rel-(1R,2R)-2-Methoxycyclohexanol is a chiral organic compound characterized by its cyclohexane ring structure with a methoxy group (-OCH3) and a hydroxyl group (-OH) attached to the second carbon. This compound exhibits stereoisomerism due to the presence of chiral centers, specifically at the first and second carbon atoms of the cyclohexane ring. It is typically a colorless to pale yellow liquid with a pleasant odor, and it is soluble in organic solvents while having limited solubility in water. The presence of both the methoxy and hydroxyl functional groups contributes to its potential reactivity, making it a candidate for various chemical reactions, including etherification and oxidation. Additionally, its chirality may impart specific biological activities, making it of interest in pharmaceutical applications. The compound's physical and chemical properties, such as boiling point and density, can vary based on purity and environmental conditions, but it is generally stable under standard laboratory conditions.
Formula:C7H14O2
InChI:InChI=1/C7H14O2/c1-9-7-5-3-2-4-6(7)8/h6-8H,2-5H2,1H3/t6-,7-/s2
InChI key:InChIKey=DCQQZLGQRIVCNH-WZTWBHKBNA-N
SMILES:O(C)[C@H]1[C@H](O)CCCC1
Synonyms:- Cyclohexanol, 2-methoxy-, trans-
- trans-2-Methoxycyclohexanol
- Cyclohexanol, 2-methoxy-, (1R,2R)-rel-
- trans-1-Hydroxy-2-methoxycyclohexane
- rel-(1R,2R)-2-Methoxycyclohexanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.