CymitQuimica logo

CAS 74292-75-4

:

1,8-Naphthyridine, 3-chloro-2,4-dimethyl-

Description:
1,8-Naphthyridine, 3-chloro-2,4-dimethyl- is a heterocyclic organic compound characterized by a fused bicyclic structure containing nitrogen atoms in its ring system. The presence of chlorine and methyl groups at specific positions on the naphthyridine framework contributes to its unique chemical properties. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry and drug development. The chlorine atom can enhance the compound's reactivity and influence its pharmacological properties, while the methyl groups may affect its lipophilicity and overall stability. Additionally, 1,8-naphthyridine derivatives are known for their diverse biological activities, including antimicrobial and antitumor properties. As with many nitrogen-containing heterocycles, this compound may also participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions, making it a versatile building block in organic synthesis.
Formula:C10H9ClN2
InChI:InChI=1S/C10H9ClN2/c1-6-8-4-3-5-12-10(8)13-7(2)9(6)11/h3-5H,1-2H3
InChI key:InChIKey=WKUVYAAWGMJCST-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=C(C)C1Cl)N=CC=C2
Synonyms:
  • 1,8-Naphthyridine, 3-chloro-2,4-dimethyl-
  • 3-Chloro-2,4-dimethyl-1,8-naphthyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.