CymitQuimica logo

CAS 74295-62-8

:

1-(butan-2-yl)pyrrolidine-2,5-dione

Description:
1-(Butan-2-yl)pyrrolidine-2,5-dione, also known as a derivative of pyrrolidine, is a cyclic compound characterized by its five-membered ring structure containing both nitrogen and carbon atoms. This compound features a butan-2-yl substituent, which contributes to its hydrophobic characteristics, enhancing its solubility in organic solvents. The presence of the dione functional groups (two carbonyl groups) in the pyrrolidine ring imparts reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. The compound's molecular structure suggests it may exhibit interesting biological activities, potentially serving as a scaffold for drug development. Additionally, its stability and reactivity can be influenced by factors such as temperature and pH, which are important considerations in synthetic applications. Overall, 1-(butan-2-yl)pyrrolidine-2,5-dione represents a versatile compound with potential utility in organic synthesis and medicinal chemistry.
Formula:C8H13NO2
InChI:InChI=1/C8H13NO2/c1-3-6(2)9-7(10)4-5-8(9)11/h6H,3-5H2,1-2H3
Synonyms:
  • methylpropylsuccinimide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.