CymitQuimica logo

CAS 74298-73-0

:

2H-Benzimidazol-2-one, 1-[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl]-1,3-dihydro-, hydrochloride (1:?)

Description:
2H-Benzimidazol-2-one, 1-[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl]-1,3-dihydro-, hydrochloride (CAS 74298-73-0) is a chemical compound characterized by its complex structure, which includes a benzimidazole core and a piperidine moiety. This compound typically exhibits properties such as solubility in polar solvents, which is common for hydrochloride salts, and may demonstrate biological activity due to its structural features. The presence of a fluorophenyl group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's hydrochloride form indicates that it is a salt, which can enhance its stability and solubility in aqueous environments. Additionally, the presence of a ketone functional group may contribute to its reactivity and potential pharmacological properties. Overall, this compound's unique structural characteristics may position it as a candidate for further research in drug development or other applications in the field of chemistry.
Formula:C22H24FN3O2·xClH
InChI:InChI=1S/C22H24FN3O2.ClH/c23-17-9-7-16(8-10-17)21(27)6-3-13-25-14-11-18(12-15-25)26-20-5-2-1-4-19(20)24-22(26)28;/h1-2,4-5,7-10,18H,3,6,11-15H2,(H,24,28);1H
InChI key:InChIKey=IHYBCZWYTSHJHF-UHFFFAOYSA-N
SMILES:O=C1N(C=2C(N1)=CC=CC2)C3CCN(CCCC(=O)C4=CC=C(F)C=C4)CC3.Cl
Synonyms:
  • 2H-Benzimidazol-2-one, 1-[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl]-1,3-dihydro-, hydrochloride
  • 2H-Benzimidazol-2-one, 1-[1-[4-(4-fluorophenyl)-4-oxobutyl]-4-piperidinyl]-1,3-dihydro-, hydrochloride (1:?)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.