
CAS 74305-05-8
:2-Bromocycloheptanol
Description:
2-Bromocycloheptanol is an organic compound characterized by a cycloheptane ring with a hydroxyl group (-OH) and a bromine atom (Br) attached to the second carbon of the ring. This compound is classified as a secondary alcohol due to the presence of the hydroxyl group on a carbon that is bonded to two other carbon atoms. The bromine substituent introduces reactivity, making it a potential candidate for nucleophilic substitution reactions. 2-Bromocycloheptanol is typically a colorless to pale yellow liquid, and its physical properties include moderate solubility in polar solvents due to the hydroxyl group, while the bromine atom can influence its reactivity and boiling point. The compound can be synthesized through various methods, including bromination of cycloheptanol or related precursors. Its applications may extend to organic synthesis, where it can serve as an intermediate in the preparation of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks associated with brominated organic compounds.
Formula:C7H13BrO
InChI:InChI=1S/C7H13BrO/c8-6-4-2-1-3-5-7(6)9/h6-7,9H,1-5H2
InChI key:InChIKey=ZVAKWPYIARQXGC-UHFFFAOYSA-N
SMILES:BrC1C(O)CCCCC1
Synonyms:- 2-Bromocycloheptan-1-ol
- Cycloheptanol, 2-bromo-
- 2-Bromocycloheptanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.