CAS 74305-52-5
:1-[4-(2-methylpropyl)phenyl]ethanamine
Description:
1-[4-(2-methylpropyl)phenyl]ethanamine, also known as a substituted phenethylamine, is a chemical compound characterized by its amine functional group and a branched alkyl substituent. This compound features a phenyl ring substituted with a 2-methylpropyl group at the para position, which influences its steric and electronic properties. The presence of the ethanamine group indicates that it has an amino (-NH2) functional group attached to an ethyl chain, contributing to its potential as a ligand in various chemical reactions. The molecular structure suggests that it may exhibit hydrophobic characteristics due to the alkyl chain, which can affect its solubility in organic solvents. Additionally, compounds of this class may interact with biological systems, potentially exhibiting psychoactive properties or serving as precursors in the synthesis of pharmaceuticals. Safety and handling precautions should be observed, as with many amines, due to potential toxicity and reactivity. Overall, this compound's unique structure positions it as a subject of interest in both synthetic chemistry and pharmacology.
Formula:C12H19N
InChI:InChI=1/C12H19N/c1-9(2)8-11-4-6-12(7-5-11)10(3)13/h4-7,9-10H,8,13H2,1-3H3
SMILES:CC(C)Cc1ccc(cc1)C(C)N
Synonyms:- 1-(4-Isobutylphenyl)Ethanamine
- Benzenemethanamine, alpha-methyl-4-(2-methylpropyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenemethanamine, α-methyl-4-(2-methylpropyl)-
CAS:Formula:C12H19NPurity:96%Color and Shape:LiquidMolecular weight:177.28601-(4-Isobutylphenyl)ethanamine
CAS:1-(4-Isobutylphenyl)ethanaminePurity:96%Molecular weight:177.29g/mol1-(4-Isobutyl-phenyl)-ethylamine
CAS:1-(4-Isobutyl-phenyl)-ethylamine is a versatile compound that has various applications in different fields. It can be used as a hydrogen fluoride scavenger, effectively removing hydrogen atoms from reaction solutions. This compound is also used as a diketone precursor for the synthesis of radionuclides. Additionally, 1-(4-Isobutyl-phenyl)-ethylamine is commonly employed in the production of polymersomes, which are polymeric vesicles with great potential in drug delivery systems. Its reactive nature makes it suitable for use in organic solutions and it acts as a polyfunctional building block for the synthesis of various polymers. Furthermore, this compound serves as an absorbent polymer for the removal of fluorine from industrial waste streams due to its high quantum yield and nitro functionality. Research Chemicals offers high-quality 1-(4-Isobutyl-phenyl)-ethylamine for all your scientific needs.Formula:C12H19NPurity:Min. 95%Molecular weight:177.29 g/mol



