CAS 74305-97-8
:3-iodo-N'-phenylbenzohydrazide
Description:
3-Iodo-N'-phenylbenzohydrazide is an organic compound characterized by its hydrazide functional group, which is linked to a phenyl group and an iodo substituent. This compound typically exhibits a crystalline solid form and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the aromatic rings. The presence of the iodine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. The compound may also exhibit biological activity, which can be of interest in medicinal chemistry. Its structure suggests potential applications in the synthesis of more complex molecules or as a reagent in organic synthesis. Additionally, the presence of both hydrazide and aromatic functionalities may impart unique properties, such as the ability to form hydrogen bonds or engage in π-π stacking interactions. As with many organic compounds, safety precautions should be taken when handling 3-iodo-N'-phenylbenzohydrazide, as it may pose health risks or environmental hazards.
Formula:C13H11IN2O
InChI:InChI=1/C13H11IN2O/c14-11-6-4-5-10(9-11)13(17)16-15-12-7-2-1-3-8-12/h1-9,15H,(H,16,17)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzoic acid, m-iodo-, 2-phenylhydrazide
CAS:Benzoic acid, m-iodo-, 2-phenylhydrazide is a bioactive chemical.Formula:C13H11IN2OColor and Shape:SolidMolecular weight:338.14
