CAS 7431-83-6
:Quercetin 3-O-gentiobioside
Description:
Quercetin 3-O-gentiobioside is a flavonoid glycoside, a type of plant secondary metabolite known for its antioxidant properties. It is derived from quercetin, a well-studied flavonoid, and is characterized by the presence of a gentiobiose sugar moiety attached at the 3-position of the quercetin molecule. This compound is typically found in various plants, particularly in fruits, vegetables, and herbs, contributing to their health benefits. Quercetin 3-O-gentiobioside exhibits potential biological activities, including anti-inflammatory, antiviral, and anticancer effects, making it of interest in pharmacological research. Its solubility and stability can vary depending on the pH and the presence of other compounds, which can influence its bioavailability and efficacy. The compound is often studied for its role in traditional medicine and its potential applications in dietary supplements and functional foods. Overall, Quercetin 3-O-gentiobioside represents a significant area of interest in the field of natural products and health sciences.
Formula:C27H30O17
InChI:InChI=1S/C27H30O17/c28-6-14-17(33)20(36)22(38)26(42-14)40-7-15-18(34)21(37)23(39)27(43-15)44-25-19(35)16-12(32)4-9(29)5-13(16)41-24(25)8-1-2-10(30)11(31)3-8/h1-5,14-15,17-18,20-23,26-34,36-39H,6-7H2/t14-,15-,17-,18-,20+,21+,22-,23-,26-,27+/m1/s1
InChI key:InChIKey=FDRQPMVGJOQVTL-DEFKTLOSSA-N
SMILES:O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3)[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O
Synonyms:- 2-(3,4-Dihydroxyphenyl)-3-[(6-O-β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]-5,7-dihydroxy-4H-1-benzopyran-4-one
- 3,3',4',5,7-Pentahydroxyflavone 3-gentiobioside
- 3,3′,4′,5,7-Pentahydroxyflavone 3-gentiobioside
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3-[(6-O-β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]-5,7-dihydroxy-
- Flavone, 3,3′,4′,5,7-pentahydroxy-, 3-(6-O-β-<span class="text-smallcaps">D</smallcap>-glucopyranosyl-β-<smallcap>D</span>-glucopyranoside)
- Quercetin 3-O-(6′′-O-glucosyl)glucoside
- Quercetin 3-O-[β-<span class="text-smallcaps">D</smallcap>-glucosyl-(1→6)-β-<smallcap>D</span>-glucoside]
- Quercetin 3-O-gentiobioside
- Quercetin 3-O-β-gentiobioside
- Quercetin 3β-gentiobioside
- Quercetin-3-gentiobioside
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-5,7-dihydroxy-
- 2-(3,4-Dihydroxyphenyl)-3-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-5,7-dihydroxy-4H-1-benzopyran-4-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Quercetin 3-gentiobioside
CAS:Quercetin 3-gentiobioside from A. iwayomogi blocks AR and stops AGEs formation.Formula:C27H30O17Purity:98.75% - 99.94%Color and Shape:SolidMolecular weight:626.52Quercetin 3-gentiobioside
CAS:Quercetin-3-gentiobioside may show significant inhibitor on AR and AGEs formation activities.Formula:C27H30O17Purity:95%~99%Molecular weight:626.52Quercetin 3-gentiobioside
CAS:Natural glycosideFormula:C27H30O17Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:626.53Quercetin 3-O-gentiobioside
CAS:<p>Quercetin 3-O-gentiobioside is a flavonoid glycoside, which is a plant-derived compound known for its potential health benefits. This compound is predominantly sourced from various plant species, where it functions as part of the plant's defense mechanisms. The mode of action of Quercetin 3-O-gentiobioside primarily involves its antioxidant properties, allowing it to scavenge free radicals and reduce oxidative stress within biological systems.</p>Formula:C27H30O17Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:626.52 g/molquercetin 3-O-gentobioside
CAS:Formula:C27H30O17Purity:98%Color and Shape:SolidMolecular weight:626.5169Ref: IN-DA00FEKJ
Discontinued product







