CAS 74311-48-1

Triptophenolide methyl ether

Description:

Triptophenolide methyl ether is a chemical compound that belongs to the class of phenolic compounds, specifically derived from triptophenolides. It is characterized by its complex molecular structure, which includes a methoxy group (-OCH3) attached to a phenolic framework. This compound is typically recognized for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. Triptophenolide methyl ether may exhibit solubility in organic solvents, while its stability can be influenced by environmental conditions such as pH and temperature. The compound's reactivity is often associated with the presence of hydroxyl groups, which can participate in various chemical reactions, including oxidation and esterification. Additionally, its unique structure may allow for interactions with biological targets, contributing to its potential therapeutic applications. As with many chemical substances, safety data and handling precautions should be observed, particularly in laboratory settings.

Formula: C₂₁H₂₆O₃

InChI: InChI=1S/C21H26O3/c1-12(2)13-5-7-17-15(19(13)23-4)6-8-18-16-11-24-20(22)14(16)9-10-21(17,18)3/h5,7,12,18H,6,8-11H2,1-4H3/t18-,21+/m0/s1

InChI key: InChIKey=JQYCSQASGZODFD-GHTZIAJQSA-N

SMILES: C[C@@]12[C@](C3=C(CC1)C(=O)OC3)(CCC=4C2=CC=C(C(C)C)C4OC)[H]

Synonyms:

• Phenanthro[1,2-c]furan-1(3H)-one, 3b,4,5,9b,10,11-hexahydro-6-methoxy-9b-methyl-7-(1-methylethyl)-, (3bR,9bS)-
• Triptophenolide methyl ether
• (3bR,9bS)-3b,4,5,9b,10,11-Hexahydro-6-methoxy-9b-methyl-7-(1-methylethyl)phenanthro[1,2-c]furan-1(3H)-one
• Phenanthro[1,2-c]furan-1(3H)-one, 3b,4,5,9b,10,11-hexahydro-6-methoxy-9b-methyl-7-(1-methylethyl)-, (3bR-trans)-

Triptophenolide methyl ether

CAS: 74311-48-1

Triptophenolide methyl ether is a bioactive compound, classified as a terpene, derived from natural plant sources. It is primarily isolated from the roots of species within the *Tripterygium* genus. Terpenes are a large and varied class of organic compounds produced by a variety of plants, known for their aromatic qualities and biological activity.

Formula: C₂₁H₂₆O₃

Purity: Min. 95%

Molecular weight: 326.43 g/mol

Ref: 3D-FT65638