CymitQuimica logo

CAS 74316-29-3

:

(1s,3r)-methyl 3-aminocyclobutane carboxylate hydrochloride

Description:
(1S,3R)-methyl 3-aminocyclobutane carboxylate hydrochloride is a chemical compound characterized by its unique bicyclic structure, which includes a cyclobutane ring. This compound features a methyl ester functional group and an amino group, contributing to its reactivity and potential biological activity. The presence of the hydrochloride indicates that it is in its salt form, which often enhances solubility in water and stability. The stereochemistry denoted by (1S,3R) suggests specific spatial arrangements of atoms, which can significantly influence the compound's pharmacological properties and interactions with biological systems. As a hydrochloride salt, it is typically more stable and easier to handle than its free base form. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could lead to specific interactions with biological targets. Its CAS number, 74316-29-3, allows for easy identification and reference in scientific literature and databases.
Formula:C6H12ClNO2
InChI:InChI=1S/C6H11NO2.ClH/c1-9-6(8)4-2-5(7)3-4;/h4-5H,2-3,7H2,1H3;1H
InChI key:BTPCSIFZLLWYTE-UHFFFAOYSA-N
SMILES:COC(=O)C1CC(C1)N.Cl
Synonyms:
  • Methyl Trans-3-Amino-Cyclobutanecarboxylate Hydrochloride
Found 5 products.