CymitQuimica logo

CAS 74316-55-5

:

Quinoline, 5-bromo-8-methyl-

Description:
Quinoline, 5-bromo-8-methyl- is an organic compound that belongs to the class of heterocyclic aromatic compounds, specifically the quinoline derivatives. It features a bicyclic structure composed of a benzene ring fused to a pyridine ring, with a bromine atom and a methyl group substituting at the 5 and 8 positions, respectively. This compound is characterized by its relatively high stability due to the aromatic nature of its structure, which contributes to its unique chemical reactivity. Quinoline derivatives are known for their applications in various fields, including pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The presence of the bromine atom can enhance its reactivity, making it useful in electrophilic substitution reactions. Additionally, the methyl group can influence the compound's solubility and overall chemical behavior. As with many quinoline derivatives, it may exhibit biological activity, making it of interest in medicinal chemistry. Proper handling and safety measures should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C10H8BrN
InChI:InChI=1S/C10H8BrN/c1-7-4-5-9(11)8-3-2-6-12-10(7)8/h2-6H,1H3
InChI key:REIFWJGDIKRUSB-UHFFFAOYSA-N
SMILES:CC1=C2C(=C(C=C1)Br)C=CC=N2
Found 4 products.