
CAS 74316-57-7
:8-Methyl-5-quinolinecarbonitrile
Description:
8-Methyl-5-quinolinecarbonitrile is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a methyl group at the 8-position and a cyano group at the 5-position contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is known for its potential applications in pharmaceuticals and organic synthesis. It may exhibit fluorescence and has been studied for its biological activities, including antimicrobial and anticancer properties. The cyano group enhances its reactivity, making it a useful intermediate in various chemical reactions. Additionally, 8-Methyl-5-quinolinecarbonitrile may have specific solubility characteristics, often being soluble in organic solvents while showing limited solubility in water. Safety data should be consulted for handling, as with many organic compounds, it may pose health risks if ingested or inhaled. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry.
Formula:C11H8N2
InChI:InChI=1S/C11H8N2/c1-8-4-5-9(7-12)10-3-2-6-13-11(8)10/h2-6H,1H3
InChI key:InChIKey=NXNVSODDFDVEAH-UHFFFAOYSA-N
SMILES:C(#N)C=1C2=C(C(C)=CC1)N=CC=C2
Synonyms:- 5-Quinolinecarbonitrile, 8-methyl-
- 8-Methyl-5-quinolinecarbonitrile
- 8-Methylquinoline-5-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.