CymitQuimica logo

CAS 74317-45-6

:

N-Hydroxy-1-methyl-5H-pyrido[4,3-b]indol-3-amine

Description:
N-Hydroxy-1-methyl-5H-pyrido[4,3-b]indol-3-amine, identified by its CAS number 74317-45-6, is a chemical compound that features a pyridoindole structure, which is characterized by a fused ring system containing both pyridine and indole moieties. This compound is notable for its N-hydroxy functional group, which can influence its reactivity and biological activity. Typically, compounds of this nature may exhibit properties such as potential antioxidant activity, and they may be investigated for their roles in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the hydroxylamine group suggests that it may participate in various chemical reactions, including those involving nitrosation or redox processes. Additionally, the methyl group attached to the nitrogen can affect the compound's lipophilicity and overall pharmacokinetic properties. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its biological properties and potential applications.
Formula:C12H11N3O
InChI:InChI=1S/C12H11N3O/c1-7-12-8-4-2-3-5-9(8)14-10(12)6-11(13-7)15-16/h2-6,14,16H,1H3,(H,13,15)
InChI key:InChIKey=VWXMRYZUBOAGIS-UHFFFAOYSA-N
SMILES:CC1=C2C=3C(NC2=CC(=NO)N1)=CC=CC3
Synonyms:
  • 5H-Pyrido[4,3-b]indol-3-amine, N-hydroxy-1-methyl-
  • 3-Hydroxyamino-1-methyl-5H-pyrido(4,3-b)indole
  • N-hydroxy-Trp-P-2
  • N-Hydroxy-1-methyl-5H-pyrido[4,3-b]indol-3-amine
  • 3-Hydroxyamino-1-methyl-5H-pyrido[4,3-b]indole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.