CAS 74317-85-4

2-bromo-4-methoxybenzoic acid

Description:

2-Bromo-4-methoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a methoxy group on a benzoic acid framework. The molecular structure features a bromine substituent at the second position and a methoxy group at the fourth position of the benzene ring, contributing to its unique chemical properties. This compound typically appears as a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, such as esterification and nucleophilic substitution. The presence of the bromine atom can enhance its reactivity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the methoxy group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules.

Formula: C₈H₇BrO₃

InChI: InChI=1/C8H7BrO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4H,1H3,(H,10,11)

SMILES: COc1ccc(c(c1)Br)C(=O)O

Synonyms:

• Benzoic acid, 2-bromo-4-methoxy-
• 2-Bromo-4-MethoxybenzoicAcid

2-Bromo-4-methoxybenzoic acid

CAS: 74317-85-4

Formula: C₈H₇BrO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 231.0434

Ref: IN-DA00335G

2-Bromo-4-methoxybenzoic acid

CAS: 74317-85-4

2-Bromo-4-methoxybenzoic acid

Formula: C₈H₇BrO₃

Purity: 98%

Color and Shape: off white powder

Molecular weight: 231.04g/mol

Ref: 54-OR51862

2-Bromo-4-methoxybenzoic acid

CAS: 74317-85-4

Formula: C₈H₇BrO₃

Purity: 97%

Color and Shape: Solid, Powder

Molecular weight: 231.045

Ref: 10-F038752

2-Bromo-4-methoxybenzoic acid

Controlled Product

CAS: 74317-85-4

Applications 2-Bromo-4-methoxybenzoic acid
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₈H₇BrO₃

Color and Shape: Neat

Molecular weight: 231.04

Ref: TR-B696585