
CAS 7433-46-7
:N-Hydroxy-N′-methylurea
Description:
N-Hydroxy-N′-methylurea, with the CAS number 7433-46-7, is an organic compound that belongs to the class of ureas. It is characterized by the presence of a hydroxyl group (-OH) attached to the nitrogen atom of the urea moiety, which contributes to its reactivity and potential applications in various chemical processes. This compound typically appears as a white crystalline solid and is soluble in water, which enhances its utility in biological and chemical systems. N-Hydroxy-N′-methylurea is known for its role as a reagent in organic synthesis, particularly in the formation of nitrogen-containing compounds. Additionally, it has been studied for its potential applications in pharmaceuticals and agrochemicals due to its ability to act as a hydroxylating agent. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks if ingested or inhaled. Proper laboratory practices and safety protocols are essential when working with this compound.
Formula:C2H6N2O2
InChI:InChI=1S/C2H6N2O2/c1-3-2(5)4-6/h6H,1H3,(H2,3,4,5)
InChI key:InChIKey=CMOKUAFPPCEHHF-UHFFFAOYSA-N
SMILES:C(NC)(NO)=O
Synonyms:- SQ 10708
- 3-Methyl-1-hydroxyurea
- Urea, 1-hydroxy-3-methyl-
- Urea, N-hydroxy-N′-methyl-
- N-Hydroxy-N′-methylurea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.