CAS 74331-49-0
:1-azabicyclo[3.3.1]nonan-2-one
Description:
1-Azabicyclo[3.3.1]nonan-2-one, with the CAS number 74331-49-0, is a bicyclic organic compound characterized by its unique structure, which includes a nitrogen atom incorporated into a bicyclic framework. This compound features a nonanone structure, indicating the presence of a ketone functional group at the second position of the bicyclic system. The bicyclic nature contributes to its rigidity and potential for specific stereochemical configurations. Typically, such compounds exhibit interesting chemical reactivity due to the strain and electronic effects associated with their cyclic structures. They may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, 1-azabicyclo[3.3.1]nonan-2-one may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural properties that can influence biological activity. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the compound. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C8H13NO
InChI:InChI=1/C8H13NO/c10-8-4-3-7-2-1-5-9(8)6-7/h7H,1-6H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.