
CAS 743374-53-0
:6-Ethyl-7,8-dihydroimidazo[1,5-c]pyrimidin-5(6H)-one
Description:
6-Ethyl-7,8-dihydroimidazo[1,5-c]pyrimidin-5(6H)-one is a heterocyclic organic compound characterized by its fused imidazole and pyrimidine rings. This compound features an ethyl group at the 6-position and a carbonyl group at the 5-position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carbonyl group, which can engage in hydrogen bonding. The structure suggests potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular framework allows for various functionalizations, which can enhance its pharmacological properties. The compound's CAS number, 743374-53-0, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, 6-Ethyl-7,8-dihydroimidazo[1,5-c]pyrimidin-5(6H)-one represents a class of compounds that may have applications in drug discovery and development.
Formula:C8H11N3O
InChI:InChI=1S/C8H11N3O/c1-2-10-4-3-7-5-9-6-11(7)8(10)12/h5-6H,2-4H2,1H3
InChI key:InChIKey=FSBVJSSLHUBOIV-UHFFFAOYSA-N
SMILES:O=C1N2C(CCN1CC)=CN=C2
Synonyms:- 6-Ethyl-7,8-dihydroimidazo[1,5-c]pyrimidin-5(6H)-one
- 6-Ethyl-7,8-dihydro-6H-imidazo[1,5-c]pyrimidin-5-one
- Imidazo[1,5-c]pyrimidin-5(6H)-one, 6-ethyl-7,8-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.