CAS 74338-19-5

4-(2-Fluorophenoxy)-3-(trifluoromethyl)benzenamine

Description:

4-(2-Fluorophenoxy)-3-(trifluoromethyl)benzenamine, with the CAS number 74338-19-5, is an organic compound characterized by its complex aromatic structure. It features a fluorophenyl group and a trifluoromethyl group, which contribute to its unique chemical properties. The presence of the amino group (-NH2) indicates that it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is likely to exhibit moderate to high lipophilicity due to the presence of multiple fluorine atoms, which can influence its solubility and reactivity in organic solvents. Additionally, the fluorine substituents can enhance the compound's stability and alter its electronic properties, making it of interest in medicinal chemistry and material science. Its potential applications may include use as an intermediate in the synthesis of pharmaceuticals or agrochemicals, as well as in the development of functional materials. Safety and handling precautions should be observed due to the presence of fluorinated groups, which can pose environmental and health risks.

Formula: C₁₃H₉F₄NO

InChI: InChI=1S/C13H9F4NO/c14-10-3-1-2-4-12(10)19-11-6-5-8(18)7-9(11)13(15,16)17/h1-7H,18H2

InChI key: InChIKey=ISFWLTCIWFREGG-UHFFFAOYSA-N

SMILES: O(C1=C(C(F)(F)F)C=C(N)C=C1)C2=C(F)C=CC=C2

Synonyms:

• 4-(2-Fluorophenoxy)-3-(trifluoromethyl)benzenamine
• Benzenamine, 4-(2-fluorophenoxy)-3-(trifluoromethyl)-