CAS 74341-63-2
:α-Amino-3-hydroxy-5-methylisoxazole-4-propionic acid
Description:
α-Amino-3-hydroxy-5-methylisoxazole-4-propionic acid, commonly known as AMPA, is a synthetic amino acid and a potent agonist of the AMPA subtype of glutamate receptors in the central nervous system. It is characterized by its structure, which includes an isoxazole ring, contributing to its bioactivity. AMPA plays a crucial role in fast synaptic transmission in the brain and is involved in various neurological processes, including learning and memory. The compound is typically soluble in water and exhibits a relatively low molecular weight. Its pharmacological properties make it a significant compound in neuroscience research, particularly in studies related to excitatory neurotransmission and neuroplasticity. Additionally, AMPA is often used in experimental settings to investigate the mechanisms of synaptic transmission and the effects of glutamate receptor modulation. Safety and handling precautions are essential when working with AMPA, as with any chemical substance, to mitigate potential risks associated with its use in laboratory environments.
Formula:C7H10N2O4
InChI:InChI=1S/C7H10N2O4/c1-3-4(6(10)9-13-3)2-5(8)7(11)12/h5H,2,8H2,1H3,(H,9,10)(H,11,12)
InChI key:InChIKey=UUDAMDVQRQNNHZ-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)N)C=1C(=O)NOC1C
Synonyms:- (R,S)-α-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid
- (RS)-α-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid
- (±)-α-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid
- 2-Amino-3-(3-hydroxy-5-methyl-1,2-oxazol-4-yl)propanoic acid
- 2-Amino-3-(5-methyl-3-oxo-2,3-dihydro-1,2-oxazol-4-yl)propanoic acid
- 2-Amino-3-(5-methyl-3-oxo-2,3-dihydroisoxazol-4-yl)propanoic acid
- 3-(3-Hydroxy-5-methyl-1,2-oxazol-4-yl)-D-alanine
- 3-(3-Hydroxy-5-methyl-1,2-oxazol-4-yl)alanine
- 4-Isoxazolepropanoic acid, alpha-amino-3-hydroxy-5-methyl-, (alphaR)-
- 4-Isoxazolepropanoic acid, α-amino-2,3-dihydro-5-methyl-3-oxo-
- <span class="text-smallcaps">D</smallcap>,<smallcap>L</span>-α-Amino-3-hydroxy-5-methylisoxazole-4-propionic acid
- AMPA (pharmaceutical)
- dl-α-Amino-3-hydroxy-5-methylisoxazole-4-propionic acid
- α-Amino-2,3-dihydro-5-methyl-3-oxo-4-isoxazolepropanoic acid
- α-Amino-2,3-dihydro-5-methyl-3-oxoisoxazole-4-propionic acid
- α-Amino-3-hydroxy-5-methyl-4-isoxazolepropionate
- α-Amino-3-hydroxy-5-methylisoxazole-4-propionic acid
- γ-Amino-3-hydroxy-5-methylisoxazole-4-propionic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(+/-)-α-Amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid
CAS:<p>Selective quisqualate agonist</p>Formula:C7H10N2O4Molecular weight:186.17AMPA
CAS:<p>AMPA is a research chemical known for its activated disinfecting properties. It belongs to the group of aromatic hydrocarbons and has been found to have various applications. AMPA is derived from l-tyrosine and dopamine, making it a potent compound with potential therapeutic benefits. It contains benzalkonium chloride, which is a powerful disinfectant commonly used in industrial settings. Additionally, AMPA exhibits carotenoid-like properties and is rich in glutamate, which plays a crucial role in brain function. Its particulate nature makes it suitable for various industrial applications. AMPA also contains xanthophylls, which are natural pigments with antioxidant properties. With its unique characteristics, AMPA offers a wide range of possibilities for research and development purposes.</p>Formula:C7H10N2O4Purity:Min. 95%Molecular weight:186.17 g/mol

