CymitQuimica logo

CAS 74341-77-8

:

N-[2-(1,3-benzodioxol-5-yl)-1-methylethyl]propan-1-amine hydrochloride

Description:
N-[2-(1,3-benzodioxol-5-yl)-1-methylethyl]propan-1-amine hydrochloride, with the CAS number 74341-77-8, is a chemical compound that belongs to the class of substituted amphetamines. It features a propan-1-amine backbone with a benzodioxole moiety, which contributes to its unique properties. This compound is typically characterized by its potential psychoactive effects, often associated with stimulant activity. The presence of the hydrochloride salt form enhances its solubility in water, making it more suitable for various applications, including research and potential therapeutic uses. The compound's structure suggests it may interact with neurotransmitter systems, particularly those involving dopamine and serotonin, although specific pharmacological profiles can vary. As with many substances in this category, safety and regulatory considerations are paramount, and it is essential to handle it with care in laboratory settings. Overall, N-[2-(1,3-benzodioxol-5-yl)-1-methylethyl]propan-1-amine hydrochloride represents a compound of interest in both chemical research and pharmacology.
Formula:C13H20ClNO2
InChI:InChI=1/C13H19NO2.ClH/c1-3-6-14-10(2)7-11-4-5-12-13(8-11)16-9-15-12;/h4-5,8,10,14H,3,6-7,9H2,1-2H3;1H
SMILES:CCCNC(C)Cc1ccc2c(c1)OCO2.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.