CymitQuimica logo

CAS 743419-80-9

:

3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine

Description:
3-(Trifluoromethyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrazole ring fused to a pyridine ring. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both nitrogen-containing rings that can interact with biological targets. Additionally, the trifluoromethyl group can enhance metabolic stability and influence pharmacokinetic properties. As with many heterocycles, it may also exhibit interesting electronic properties, making it a subject of interest in materials science and organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, particularly those containing fluorinated groups.
Formula:C7H8F3N3
InChI:InChI=1/C7H8F3N3/c8-7(9,10)6-4-3-11-2-1-5(4)12-13-6/h11H,1-3H2,(H,12,13)
SMILES:C1CNCc2c1[nH]nc2C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.