CAS 743442-07-1

2-Chloro-N-[4-(6-methyl-2-benzothiazolyl)phenyl]propanamide

Description:

2-Chloro-N-[4-(6-methyl-2-benzothiazolyl)phenyl]propanamide, with the CAS number 743442-07-1, is a synthetic organic compound characterized by its unique structural features. It contains a chloro group, a propanamide functional group, and a benzothiazole moiety, which contributes to its potential biological activity. The presence of the benzothiazole ring, known for its diverse pharmacological properties, suggests that this compound may exhibit interesting interactions with biological targets. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its hydrophobic characteristics due to the aromatic and heterocyclic components. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the chlorine substituent may influence its reactivity and biological interactions, making it a candidate for further research in drug discovery or chemical synthesis. As with any chemical substance, proper handling and safety measures should be observed due to potential toxicity or environmental impact.

Formula: C₁₇H₁₅ClN₂OS

InChI: InChI=1S/C17H15ClN2OS/c1-10-3-8-14-15(9-10)22-17(20-14)12-4-6-13(7-5-12)19-16(21)11(2)18/h3-9,11H,1-2H3,(H,19,21)

InChI key: InChIKey=DIRLVHMWHQTTIE-UHFFFAOYSA-N

SMILES: N(C(C(C)Cl)=O)C1=CC=C(C2=NC=3C(S2)=CC(C)=CC3)C=C1

Synonyms:

• 2-Chloro-N-[4-(6-methyl-2-benzothiazolyl)phenyl]propanamide
• Propanamide, 2-chloro-N-[4-(6-methyl-2-benzothiazolyl)phenyl]-

2-Chloro-N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]propanamide

CAS: 743442-07-1

Versatile small molecule scaffold

Formula: C₁₇H₁₅ClN₂OS

Purity: Min. 95%

Molecular weight: 330.8 g/mol

Ref: 3D-TEB44207