CymitQuimica logo

CAS 743442-09-3

:

4-[5-(Chloromethyl)-1,3,4-oxadiazol-2-yl]-2-(3,4-dimethoxyphenyl)quinoline

Description:
4-[5-(Chloromethyl)-1,3,4-oxadiazol-2-yl]-2-(3,4-dimethoxyphenyl)quinoline is a synthetic organic compound characterized by its complex structure, which includes a quinoline core fused with an oxadiazole ring. The presence of the chloromethyl group enhances its reactivity, making it a potential candidate for further chemical modifications. The dimethoxyphenyl substituent contributes to its aromatic character and may influence its solubility and interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, which may include antimicrobial or anticancer activities, although specific biological data would be necessary to confirm these effects. Its molecular structure suggests that it may exhibit unique electronic properties, making it suitable for applications in organic electronics or as a fluorescent probe. As with many synthetic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can pose health risks. Further research is essential to fully elucidate its properties and potential applications in various fields.
Formula:C20H16ClN3O3
InChI:InChI=1S/C20H16ClN3O3/c1-25-17-8-7-12(9-18(17)26-2)16-10-14(20-24-23-19(11-21)27-20)13-5-3-4-6-15(13)22-16/h3-10H,11H2,1-2H3
InChI key:InChIKey=BYSLZCJOKOYXBP-UHFFFAOYSA-N
SMILES:C(Cl)C=1OC(C=2C3=C(N=C(C2)C4=CC(OC)=C(OC)C=C4)C=CC=C3)=NN1
Synonyms:
  • Quinoline, 4-[5-(chloromethyl)-1,3,4-oxadiazol-2-yl]-2-(3,4-dimethoxyphenyl)-
  • 4-[5-(Chloromethyl)-1,3,4-oxadiazol-2-yl]-2-(3,4-dimethoxyphenyl)quinoline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.