CAS 743444-22-6

2-Chloro-N-(3-chloro-9,10-dihydro-9,10-dioxo-2-anthracenyl)propanamide

Description:

2-Chloro-N-(3-chloro-9,10-dihydro-9,10-dioxo-2-anthracenyl)propanamide is a synthetic organic compound characterized by its complex structure, which includes an anthracene moiety and amide functional group. The presence of chlorine atoms in its structure contributes to its reactivity and potential biological activity. This compound is likely to exhibit properties typical of chlorinated organic compounds, such as increased lipophilicity and potential for interaction with biological systems. The amide group suggests that it may participate in hydrogen bonding, influencing its solubility and stability in various solvents. Additionally, the presence of the anthracene core may impart photophysical properties, making it of interest in applications such as organic electronics or photodynamic therapy. As with many synthetic compounds, safety and handling precautions are essential, given the potential toxicity associated with chlorinated compounds. Overall, this substance represents a unique combination of structural features that may confer specific chemical and biological properties, warranting further investigation for potential applications in research and industry.

Formula: C₁₇H₁₁Cl₂NO₃

InChI: InChI=1S/C17H11Cl2NO3/c1-8(18)17(23)20-14-7-12-11(6-13(14)19)15(21)9-4-2-3-5-10(9)16(12)22/h2-8H,1H3,(H,20,23)

InChI key: InChIKey=BXVQWLADDAMMOM-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)C=3C1=CC=CC3)=CC(Cl)=C(NC(C(C)Cl)=O)C2

Synonyms:

• 2-Chloro-N-(3-chloro-9,10-dihydro-9,10-dioxo-2-anthracenyl)propanamide
• Propanamide, 2-chloro-N-(3-chloro-9,10-dihydro-9,10-dioxo-2-anthracenyl)-