CAS 743444-39-5

N-[(4-Chlorophenyl)methyl]-2-(ethylamino)acetamide

Description:

N-[(4-Chlorophenyl)methyl]-2-(ethylamino)acetamide, identified by its CAS number 743444-39-5, is a chemical compound that belongs to the class of amides. It features a structure that includes a chlorophenyl group, which contributes to its potential biological activity. The presence of the ethylamino group suggests that it may exhibit properties relevant to pharmacology, possibly influencing its interaction with biological targets. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, though its solubility in water may be limited due to its hydrophobic chlorophenyl moiety. The compound's molecular structure indicates potential for various applications, particularly in medicinal chemistry, where it may serve as a lead compound for drug development. Its specific characteristics, such as melting point, boiling point, and reactivity, would need to be determined through experimental methods or detailed literature review. Safety data and handling precautions should also be considered, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₁H₁₅ClN₂O

InChI: InChI=1S/C11H15ClN2O/c1-2-13-8-11(15)14-7-9-3-5-10(12)6-4-9/h3-6,13H,2,7-8H2,1H3,(H,14,15)

InChI key: InChIKey=YFURYGDITSLJFZ-UHFFFAOYSA-N

SMILES: C(NC(CNCC)=O)C1=CC=C(Cl)C=C1

Synonyms:

• Acetamide, N-[(4-chlorophenyl)methyl]-2-(ethylamino)-
• N-[(4-Chlorophenyl)methyl]-2-(ethylamino)acetamide

N-[(4-Chlorophenyl)methyl]-2-(ethylamino)acetamide

CAS: 743444-39-5

Versatile small molecule scaffold

Formula: C₁₁H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 226.7 g/mol

Ref: 3D-TEB44439