CAS 743444-45-3
:6-Amino-5-(2-chloroacetyl)-1-propyl-2,4(1H,3H)-pyrimidinedione
Description:
6-Amino-5-(2-chloroacetyl)-1-propyl-2,4(1H,3H)-pyrimidinedione is a chemical compound characterized by its pyrimidinedione core structure, which features a 2,4-dione functionality. This compound contains an amino group at the 6-position and a propyl group at the 1-position, contributing to its unique reactivity and potential biological activity. The presence of a 2-chloroacetyl group at the 5-position enhances its electrophilic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can interact with biological targets. Its CAS number, 743444-45-3, allows for easy identification and retrieval of information regarding its properties, safety data, and synthesis methods. Overall, this compound exemplifies the complexity and versatility of pyrimidine derivatives in chemical research and drug development.
Formula:C9H12ClN3O3
InChI:InChI=1S/C9H12ClN3O3/c1-2-3-13-7(11)6(5(14)4-10)8(15)12-9(13)16/h2-4,11H2,1H3,(H,12,15,16)
InChI key:InChIKey=BFDKKPFDHUYHQY-UHFFFAOYSA-N
SMILES:C(CCl)(=O)C1=C(N)N(CCC)C(=O)NC1=O
Synonyms:- 2,4(1H,3H)-Pyrimidinedione, 6-amino-5-(2-chloroacetyl)-1-propyl-
- 6-Amino-5-(2-chloroacetyl)-1-propyl-2,4(1H,3H)-pyrimidinedione
- 2,4(1H,3H)-Pyrimidinedione, 6-amino-5-(chloroacetyl)-1-propyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.