CAS 743444-50-0

3-[[5-(Propylthio)-1,3,4-thiadiazol-2-yl]thio]propanoic acid

Description:

3-[[5-(Propylthio)-1,3,4-thiadiazol-2-yl]thio]propanoic acid is a chemical compound characterized by its unique structure, which includes a propanoic acid moiety linked to a thiadiazole ring. The presence of the propylthio group enhances its lipophilicity, potentially influencing its biological activity and solubility. This compound features both thioether and thiol functionalities, which may contribute to its reactivity and interactions with biological systems. The thiadiazole ring is known for its diverse pharmacological properties, including antimicrobial and antifungal activities. As a carboxylic acid, it can participate in various chemical reactions, such as esterification and amidation. The compound's specific properties, such as melting point, solubility, and stability, would depend on its molecular interactions and the environment in which it is studied. Overall, 3-[[5-(Propylthio)-1,3,4-thiadiazol-2-yl]thio]propanoic acid represents a class of compounds with potential applications in medicinal chemistry and agricultural science.

Formula: C₈H₁₂N₂O₂S₃

InChI: InChI=1S/C8H12N2O2S3/c1-2-4-13-7-9-10-8(15-7)14-5-3-6(11)12/h2-5H2,1H3,(H,11,12)

InChI key: InChIKey=NMMKLLILDOVFMU-UHFFFAOYSA-N

SMILES: S(CCC(O)=O)C=1SC(SCCC)=NN1

Synonyms:

• 3-[[5-(Propylthio)-1,3,4-thiadiazol-2-yl]thio]propanoic acid
• Propanoic acid, 3-[[5-(propylthio)-1,3,4-thiadiazol-2-yl]thio]-