CymitQuimica logo

CAS 743444-55-5

:

2-Chloro-N-[2-(4-morpholinyl)-5-(trifluoromethyl)phenyl]propanamide

Description:
2-Chloro-N-[2-(4-morpholinyl)-5-(trifluoromethyl)phenyl]propanamide, with the CAS number 743444-55-5, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a morpholine moiety, and a trifluoromethyl group. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amide functional group. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. The morpholine ring contributes to the compound's overall stability and may affect its interaction with biological targets. Additionally, the presence of the chlorine atom can impart unique reactivity and influence the compound's pharmacokinetic properties. Overall, this compound is likely to be studied for its potential applications in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C14H16ClF3N2O2
InChI:InChI=1S/C14H16ClF3N2O2/c1-9(15)13(21)19-11-8-10(14(16,17)18)2-3-12(11)20-4-6-22-7-5-20/h2-3,8-9H,4-7H2,1H3,(H,19,21)
InChI key:InChIKey=CUEWKBIHPPSWBE-UHFFFAOYSA-N
SMILES:N(C(C(C)Cl)=O)C1=C(C=CC(C(F)(F)F)=C1)N2CCOCC2
Synonyms:
  • Propanamide, 2-chloro-N-[2-(4-morpholinyl)-5-(trifluoromethyl)phenyl]-
  • 2-Chloro-N-[2-(4-morpholinyl)-5-(trifluoromethyl)phenyl]propanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.