CAS 743444-59-9

1-[4-Fluoro-2-(1-pyrrolidinyl)phenyl]ethanone

Description:

1-[4-Fluoro-2-(1-pyrrolidinyl)phenyl]ethanone, with the CAS number 743444-59-9, is a chemical compound characterized by its unique structure that includes a fluorinated phenyl ring and a pyrrolidine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the fluorine atom can enhance lipophilicity and influence the compound's biological activity, making it of interest in medicinal chemistry. The ketone functional group (ethanone) suggests that it may participate in various chemical reactions, such as nucleophilic additions or reductions. Additionally, the pyrrolidine ring can impart specific steric and electronic properties, affecting the compound's overall stability and reactivity. This compound may be explored for its potential applications in pharmaceuticals or as a building block in organic synthesis, although specific biological activities and applications would require further investigation. As with any chemical substance, proper handling and safety measures should be observed due to potential hazards associated with its use.

Formula: C₁₂H₁₄FNO

InChI: InChI=1S/C12H14FNO/c1-9(15)11-5-4-10(13)8-12(11)14-6-2-3-7-14/h4-5,8H,2-3,6-7H2,1H3

InChI key: InChIKey=OEBXEPGKHBCKCZ-UHFFFAOYSA-N

SMILES: C(C)(=O)C1=C(C=C(F)C=C1)N2CCCC2

Synonyms:

• Ethanone, 1-[4-fluoro-2-(1-pyrrolidinyl)phenyl]-
• 1-[4-Fluoro-2-(1-pyrrolidinyl)phenyl]ethanone

1-[4-Fluoro-2-(pyrrolidin-1-yl)phenyl]ethan-1-one

CAS: 743444-59-9

Versatile small molecule scaffold

Formula: C₁₂H₁₄FNO

Purity: Min. 95%

Molecular weight: 207.24 g/mol

Ref: 3D-TEB44459