CAS 743444-80-6

5-Methyl-4-(2,4,5-trimethylphenyl)-2-thiazolamine

Description:

5-Methyl-4-(2,4,5-trimethylphenyl)-2-thiazolamine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methyl group and a substituted phenyl group, contributing to its unique chemical properties. The presence of multiple methyl groups on the phenyl ring enhances its hydrophobic character and may influence its reactivity and solubility in organic solvents. Thiazolamines are known for their potential biological activities, including antimicrobial and anti-inflammatory properties, making them of interest in medicinal chemistry. The compound's molecular structure suggests it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the presence of the amine functional group. Additionally, the specific arrangement of substituents can affect its electronic properties and steric hindrance, which are crucial for its interactions in biological systems. Overall, 5-Methyl-4-(2,4,5-trimethylphenyl)-2-thiazolamine represents a class of compounds with diverse applications in pharmaceuticals and agrochemicals.

Formula: C₁₃H₁₆N₂S

InChI: InChI=1S/C13H16N2S/c1-7-5-9(3)11(6-8(7)2)12-10(4)16-13(14)15-12/h5-6H,1-4H3,(H2,14,15)

InChI key: InChIKey=OXFISNMEGPNATE-UHFFFAOYSA-N

SMILES: CC1=C(N=C(N)S1)C2=C(C)C=C(C)C(C)=C2

Synonyms:

• 5-Methyl-4-(2,4,5-trimethylphenyl)-2-thiazolamine
• 2-Thiazolamine, 5-methyl-4-(2,4,5-trimethylphenyl)-