CAS 743445-13-8

4-Oxo-4-[4-[[3-(trifluoromethyl)phenyl]sulfonyl]-1-piperazinyl]-2-butenoic acid

Description:

4-Oxo-4-[4-[[3-(trifluoromethyl)phenyl]sulfonyl]-1-piperazinyl]-2-butenoic acid, with the CAS number 743445-13-8, is a synthetic organic compound characterized by its complex structure, which includes a butenoic acid moiety, a piperazine ring, and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties such as being a solid at room temperature and may be soluble in organic solvents, depending on its specific formulation. The presence of the trifluoromethyl group often imparts unique electronic and lipophilic characteristics, enhancing its biological activity. The sulfonyl group contributes to its potential as a pharmacophore, making it of interest in medicinal chemistry for developing therapeutic agents. Additionally, the compound may exhibit specific reactivity patterns due to the presence of functional groups, influencing its interactions in biological systems. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways.

Formula: C₁₅H₁₅F₃N₂O₅S

InChI: InChI=1S/C15H15F3N2O5S/c16-15(17,18)11-2-1-3-12(10-11)26(24,25)20-8-6-19(7-9-20)13(21)4-5-14(22)23/h1-5,10H,6-9H2,(H,22,23)

InChI key: InChIKey=SZOQVGKNFUSKET-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(C(F)(F)F)=CC=C1)N2CCN(C(C=CC(O)=O)=O)CC2

Synonyms:

• 4-Oxo-4-[4-[[3-(trifluoromethyl)phenyl]sulfonyl]-1-piperazinyl]-2-butenoic acid
• 2-Butenoic acid, 4-oxo-4-[4-[[3-(trifluoromethyl)phenyl]sulfonyl]-1-piperazinyl]-

4-Oxo-4-{4-[3-(trifluoromethyl)benzenesulfonyl]piperazin-1-yl}but-2-enoic acid

CAS: 743445-13-8

Versatile small molecule scaffold

Formula: C₁₅H₁₅F₃N₂O₅S

Purity: Min. 95%

Molecular weight: 392.4 g/mol

Ref: 3D-TEB44513