CymitQuimica logo

CAS 743452-16-6

:

7-Bromo-4-(chloromethyl)-2H-1-benzopyran-2-one

Description:
7-Bromo-4-(chloromethyl)-2H-1-benzopyran-2-one is a synthetic organic compound characterized by its unique structure, which includes a benzopyran moiety, a bromine atom, and a chloromethyl group. This compound typically exhibits properties associated with both halogenated and aromatic compounds, such as potential reactivity in electrophilic substitution reactions due to the presence of the bromine and chloromethyl groups. The benzopyran structure suggests that it may possess biological activity, potentially acting as a scaffold for further chemical modifications. Its molecular framework may also contribute to its solubility and stability in various solvents, influencing its applications in medicinal chemistry or as an intermediate in organic synthesis. Additionally, the presence of halogen atoms can enhance its reactivity, making it a candidate for further functionalization. As with many halogenated compounds, safety precautions should be taken during handling due to potential toxicity and environmental concerns. Overall, 7-Bromo-4-(chloromethyl)-2H-1-benzopyran-2-one represents a versatile compound with potential applications in various fields of chemistry.
Formula:C10H6BrClO2
InChI:InChI=1S/C10H6BrClO2/c11-7-1-2-8-6(5-12)3-10(13)14-9(8)4-7/h1-4H,5H2
InChI key:InChIKey=GLNYJLARXFNXTO-UHFFFAOYSA-N
SMILES:C(Cl)C=1C=2C(OC(=O)C1)=CC(Br)=CC2
Synonyms:
  • 7-Bromo-4-(chloromethyl)-2H-1-benzopyran-2-one
  • 2H-1-Benzopyran-2-one, 7-bromo-4-(chloromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.