CymitQuimica logo

CAS 743452-36-0

:

3-(2-Furanylmethyl)-2,3-dihydro-5-(2-thienyl)-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one

Description:
3-(2-Furanylmethyl)-2,3-dihydro-5-(2-thienyl)-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one is a complex organic compound characterized by its unique structural features, which include a fused thieno-pyrimidine ring system and functional groups such as a furan and thienyl moiety. This compound exhibits potential biological activity, making it of interest in medicinal chemistry and drug development. Its thioxo group contributes to its reactivity and may influence its interaction with biological targets. The presence of heteroatoms like sulfur and nitrogen in the structure can enhance its solubility and bioavailability. Additionally, the compound's stereochemistry and electronic properties may play a crucial role in its pharmacological profile. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound represents a class of thienopyrimidine derivatives that may have applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C15H10N2O2S3
InChI:InChI=1S/C15H10N2O2S3/c18-14-12-10(11-4-2-6-21-11)8-22-13(12)16-15(20)17(14)7-9-3-1-5-19-9/h1-6,8H,7H2,(H,16,20)
InChI key:InChIKey=VLQMXRCYEQTCRO-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CSC2NC(=S)N1CC3=CC=CO3)C4=CC=CS4
Synonyms:
  • 3-(2-Furanylmethyl)-2,3-dihydro-5-(2-thienyl)-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one
  • Thieno[2,3-d]pyrimidin-4(1H)-one, 3-(2-furanylmethyl)-2,3-dihydro-5-(2-thienyl)-2-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.