
CAS 743452-38-2
:5-(4-Fluorophenyl)-2,3-dihydro-3-(2-methoxyethyl)-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one
Description:
5-(4-Fluorophenyl)-2,3-dihydro-3-(2-methoxyethyl)-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one is a synthetic organic compound characterized by its complex heterocyclic structure, which includes a thieno[2,3-d]pyrimidine core. This compound features a fluorophenyl group, contributing to its potential biological activity, and a methoxyethyl substituent that may influence its solubility and reactivity. The presence of a thioxo group indicates potential for tautomerism and reactivity in various chemical environments. Its molecular structure suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's CAS number, 743452-38-2, allows for precise identification and retrieval of information in chemical databases. Overall, this compound's unique structural features may confer specific pharmacological properties, making it a subject of interest in drug discovery and development.
Formula:C15H13FN2O2S2
InChI:InChI=1S/C15H13FN2O2S2/c1-20-7-6-18-14(19)12-11(8-22-13(12)17-15(18)21)9-2-4-10(16)5-3-9/h2-5,8H,6-7H2,1H3,(H,17,21)
InChI key:InChIKey=SPOQUKDVEPJHSG-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CSC2NC(=S)N1CCOC)C3=CC=C(F)C=C3
Synonyms:- 5-(4-Fluorophenyl)-2,3-dihydro-3-(2-methoxyethyl)-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one
- Thieno[2,3-d]pyrimidin-4(1H)-one, 5-(4-fluorophenyl)-2,3-dihydro-3-(2-methoxyethyl)-2-thioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.