
CAS 743452-46-2
:3-(2-Furanylmethyl)-2,3-dihydro-5-phenyl-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one
Description:
3-(2-Furanylmethyl)-2,3-dihydro-5-phenyl-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one is a heterocyclic compound characterized by its complex structure, which includes a thieno[2,3-d]pyrimidine core fused with a thioxo group and a furan moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its unique structural features. The presence of the furan ring may contribute to its reactivity and interactions with biological targets. Additionally, the phenyl group can influence its electronic properties and stability. Such compounds are often investigated for their potential pharmacological applications, including antimicrobial or anticancer activities, owing to their ability to interact with various biological pathways. The thioxo group may also play a role in the compound's reactivity, potentially participating in nucleophilic or electrophilic reactions. Overall, this compound represents a class of thienopyrimidine derivatives that are of interest in medicinal chemistry and drug development.
Formula:C17H12N2O2S2
InChI:InChI=1S/C17H12N2O2S2/c20-16-14-13(11-5-2-1-3-6-11)10-23-15(14)18-17(22)19(16)9-12-7-4-8-21-12/h1-8,10H,9H2,(H,18,22)
InChI key:InChIKey=DGEMAWXFIMKMRL-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CSC2NC(=S)N1CC3=CC=CO3)C4=CC=CC=C4
Synonyms:- Thieno[2,3-d]pyrimidin-4(1H)-one, 3-(2-furanylmethyl)-2,3-dihydro-5-phenyl-2-thioxo-
- 3-(2-Furanylmethyl)-2,3-dihydro-5-phenyl-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.