CAS 743452-52-0

4-[[(4-Methyl-2-thiazolyl)thio]methyl]benzoic acid

Description:

4-[[(4-Methyl-2-thiazolyl)thio]methyl]benzoic acid, identified by its CAS number 743452-52-0, is a chemical compound characterized by its unique structural features. It contains a benzoic acid moiety, which contributes to its acidic properties, and a thiazole ring that imparts specific biological activity. The presence of the thiazole group, particularly with a methyl substitution, enhances its potential for interactions in biological systems. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its functional groups suggest potential applications in pharmaceuticals, particularly in the development of antimicrobial or anti-inflammatory agents. Additionally, the thioether linkage in the structure may influence its reactivity and stability. Overall, the compound's characteristics make it of interest in medicinal chemistry and material science, warranting further investigation into its properties and potential applications.

Formula: C₁₂H₁₁NO₂S₂

InChI: InChI=1S/C12H11NO2S2/c1-8-6-16-12(13-8)17-7-9-2-4-10(5-3-9)11(14)15/h2-6H,7H2,1H3,(H,14,15)

InChI key: InChIKey=NODWFSIKRNTPCY-UHFFFAOYSA-N

SMILES: C(SC1=NC(C)=CS1)C2=CC=C(C(O)=O)C=C2

Synonyms:

• 4-[[(4-Methyl-2-thiazolyl)thio]methyl]benzoic acid
• Benzoic acid, 4-[[(4-methyl-2-thiazolyl)thio]methyl]-

4-{[(4-Methyl-1,3-thiazol-2-yl)sulfanyl]methyl}benzoic acid

CAS: 743452-52-0

Versatile small molecule scaffold

Formula: C₁₂H₁₁NO₂S₂

Purity: Min. 95%

Molecular weight: 265.4 g/mol

Ref: 3D-TEB45252