CAS 743456-86-2

3-(2,5-Dimethyl-1H-pyrrol-1-yl)isoxazole

Description:

3-(2,5-Dimethyl-1H-pyrrol-1-yl)isoxazole, identified by its CAS number 743456-86-2, is a chemical compound that features a unique structure combining an isoxazole ring with a pyrrole moiety. This compound typically exhibits characteristics common to heterocyclic compounds, such as moderate to high stability under standard conditions, and may display interesting biological activities due to its nitrogen-containing rings. The presence of the dimethyl groups on the pyrrole enhances its lipophilicity, potentially influencing its solubility and reactivity. Isoxazoles are known for their diverse applications in medicinal chemistry, often serving as scaffolds for drug development. The specific electronic and steric properties of 3-(2,5-Dimethyl-1H-pyrrol-1-yl)isoxazole can lead to interactions with biological targets, making it a subject of interest in pharmacological research. Additionally, its synthesis may involve standard organic reactions such as cyclization and substitution, contributing to its utility in various chemical applications. Overall, this compound exemplifies the complexity and versatility of heterocyclic chemistry.

Formula: C₉H₁₀N₂O

InChI: InChI=1S/C9H10N2O/c1-7-3-4-8(2)11(7)9-5-6-12-10-9/h3-6H,1-2H3

InChI key: InChIKey=DPMDYFKFWQGNBS-UHFFFAOYSA-N

SMILES: CC=1N(C(C)=CC1)C=2C=CON2

Synonyms:

• 3-(2,5-Dimethyl-1H-pyrrol-1-yl)isoxazole
• Isoxazole, 3-(2,5-dimethyl-1H-pyrrol-1-yl)-