
CAS 743456-87-3
:4-[[3-(Chloromethyl)phenyl]sulfonyl]morpholine
Description:
4-[[3-(Chloromethyl)phenyl]sulfonyl]morpholine, identified by its CAS number 743456-87-3, is a chemical compound characterized by its morpholine structure, which is a six-membered ring containing both nitrogen and oxygen atoms. This compound features a sulfonyl group, which is known for its strong electron-withdrawing properties, enhancing its reactivity. The presence of the chloromethyl group on the phenyl ring contributes to its potential as a reactive intermediate in various chemical reactions, including nucleophilic substitutions. The sulfonyl moiety also imparts significant polarity to the molecule, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its unique structural features suggest potential applications in medicinal chemistry, particularly in the design of targeted therapies. However, handling and usage should be approached with caution due to the presence of the chloromethyl group, which can pose safety and environmental concerns.
Formula:C11H14ClNO3S
InChI:InChI=1S/C11H14ClNO3S/c12-9-10-2-1-3-11(8-10)17(14,15)13-4-6-16-7-5-13/h1-3,8H,4-7,9H2
InChI key:InChIKey=GGZAEHHVKQQWFO-UHFFFAOYSA-N
SMILES:S(=O)(=O)(C1=CC(CCl)=CC=C1)N2CCOCC2
Synonyms:- 4-((3-Chloromethylphenyl)sulfonyl)morpholine
- Morpholine, 4-[[3-(chloromethyl)phenyl]sulfonyl]-
- 4-[[3-(Chloromethyl)phenyl]sulfonyl]morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.