CAS 74346-19-3

4-Bromo-2,6-dimethylbenzoic acid

Description:

4-Bromo-2,6-dimethylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two methyl groups on a benzoic acid framework. The bromine substituent is located at the para position relative to the carboxylic acid group, while the methyl groups are positioned at the 2 and 6 positions of the benzene ring. This compound typically appears as a solid at room temperature and is known for its moderate solubility in organic solvents, while being less soluble in water due to the hydrophobic nature of the aromatic ring and the bulky methyl groups. It exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and nucleophilic substitution. The presence of the bromine atom can also influence its reactivity and stability, making it a useful intermediate in organic synthesis. Additionally, 4-Bromo-2,6-dimethylbenzoic acid may have applications in pharmaceuticals, agrochemicals, and materials science, depending on its specific reactivity and functionalization potential.

Formula: C₉H₉BrO₂

InChI: InChI=1/C9H9BrO2/c1-5-3-7(10)4-6(2)8(5)9(11)12/h3-4H,1-2H3,(H,11,12)

SMILES: Cc1cc(cc(C)c1C(=O)O)Br

Synonyms:

• Benzoic Acid, 4-Bromo-2,6-Dimethyl-

4-Bromo-2,6-dimethylbenzoic acid

CAS: 74346-19-3

Formula: C₉H₉BrO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 229.0706

Ref: IN-DA00FASS

4-Bromo-2,6-dimethylbenzoic acid

CAS: 74346-19-3

4-Bromo-2,6-dimethylbenzoic acid

Formula: C₉H₉BrO₂

Purity: 98%

Color and Shape: yellow solid

Molecular weight: 229.07g/mol

Ref: 54-OR907248

4-Bromo-2,6-dimethylbenzoic acid

CAS: 74346-19-3

Formula: C₉H₉BrO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 229.073

Ref: 10-F079063