
CAS 74359-07-2
:2-Propenoic acid, 2-fluoro-, 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester, homopolymer
Description:
The chemical substance known as "2-Propenoic acid, 2-fluoro-, 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester, homopolymer" with CAS number 74359-07-2 is a fluorinated polymer derived from the polymerization of a specific fluorinated monomer. This polymer exhibits unique characteristics due to the presence of fluorine atoms, which enhance its chemical stability, thermal resistance, and hydrophobic properties. The incorporation of trifluoromethyl groups contributes to its low surface energy, making it resistant to wetting and adhesion, which is advantageous in various applications, including coatings and sealants. Additionally, the polymer's structure may impart enhanced resistance to solvents and chemicals, making it suitable for use in harsh environments. Its homopolymeric nature suggests that it consists of repeating units derived from the same monomer, which can influence its mechanical properties and processing behavior. Overall, this substance is of interest in fields such as materials science and engineering, particularly for applications requiring durable and chemically resistant materials.
Formula:(C6H3F7O2)x
InChI:InChI=1S/C6H3F7O2/c1-2(7)3(14)15-4(5(8,9)10)6(11,12)13/h4H,1H2
InChI key:InChIKey=RNMOMNJMYZWWGF-UHFFFAOYSA-N
SMILES:C(OC(C(=C)F)=O)(C(F)(F)F)C(F)(F)F
Synonyms:- 2-Propenoic acid, 2-fluoro-, 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propenoic acid, 2-fluoro-, 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester, homopolymer
CAS:Formula:C6H3F7O2Molecular weight:240.0756
