CAS 74367-51-4
:5-Ethylgramine
Description:
5-Ethylgramine, identified by its CAS number 74367-51-4, is a chemical compound that belongs to the class of amines. It is characterized by the presence of an ethyl group attached to the nitrogen atom of the amine functional group, which influences its physical and chemical properties. Typically, amines like 5-Ethylgramine are known for their basicity and ability to form hydrogen bonds, which can affect their solubility in water and organic solvents. The presence of the ethyl group may also impact the compound's reactivity and interaction with other chemical species. While specific data on 5-Ethylgramine may be limited, compounds in this category often exhibit biological activity and can be used in various applications, including pharmaceuticals and agrochemicals. Safety data sheets and regulatory information should be consulted for handling and usage guidelines, as amines can sometimes be hazardous. Overall, 5-Ethylgramine represents a unique structure within the broader category of amines, with potential applications in various fields.
Formula:C13H18N2
InChI:InChI=1/C13H18N2/c1-4-10-5-6-13-12(7-10)11(8-14-13)9-15(2)3/h5-8,14H,4,9H2,1-3H3
SMILES:CCc1ccc2c(c1)c(c[nH]2)CN(C)C
Synonyms:- 1-(5-ethyl-1H-indol-3-yl)-N,N-dimethylmethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.