CAS 74377-46-1

1-(1-benzofuran-2-yl)-N-methylmethanamine

Description:

1-(1-benzofuran-2-yl)-N-methylmethanamine, with the CAS number 74377-46-1, is an organic compound characterized by its unique structure that includes a benzofuran moiety and a methylated amine group. This compound typically exhibits properties associated with both aromatic and amine functionalities, which can influence its reactivity and solubility. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry due to the presence of the benzofuran ring, which is known for its biological activity. The amine group can participate in hydrogen bonding, affecting its interaction with other molecules. Additionally, the compound may exhibit moderate to high lipophilicity, making it suitable for studies related to drug design and development. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. Overall, this compound represents a class of substances that may have significant implications in pharmaceutical research and development.

Formula: C₁₀H₁₁NO

InChI: InChI=1/C10H11NO/c1-11-7-9-6-8-4-2-3-5-10(8)12-9/h2-6,11H,7H2,1H3

SMILES: CNCc1cc2ccccc2o1

Synonyms:

• 2-benzofuranmethanamine, N-methyl-
• 1-(1-Benzofuran-2-yl)-N-methylmethanamine

(1-Benzofuran-2-ylmethyl)(methyl)amine

CAS: 74377-46-1

Versatile small molecule scaffold

Formula: C₁₀H₁₁NO

Purity: Min. 95%

Molecular weight: 161.2 g/mol

Ref: 3D-ZCA37746