CymitQuimica logo

CAS 74378-23-7

:

(9Z)-phenanthrene-9,10-dione semicarbazone

Description:
(9Z)-Phenanthrene-9,10-dione semicarbazone is an organic compound characterized by its structure, which includes a phenanthrene backbone with a dione functional group and a semicarbazone moiety. This compound typically exhibits properties associated with both aromatic hydrocarbons and carbonyl compounds, such as stability under standard conditions and potential reactivity due to the presence of the dione. The semicarbazone formation suggests that it can participate in nucleophilic addition reactions, particularly with carbonyl groups, making it useful in various synthetic applications. Its molecular structure contributes to its potential as a ligand in coordination chemistry and as a precursor in organic synthesis. Additionally, compounds of this nature may exhibit biological activity, which can be explored in pharmacological studies. The specific characteristics, such as solubility, melting point, and spectral properties, would depend on the precise conditions and environment in which the compound is studied. Overall, (9Z)-phenanthrene-9,10-dione semicarbazone represents a versatile compound with applications in both research and industry.
Formula:C15H11N3O2
InChI:InChI=1/C15H11N3O2/c16-15(20)18-17-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(13)19/h1-8H,(H3,16,18,20)/b17-13-
SMILES:c1ccc2c(c1)c1ccccc1C(=O)/C/2=N\NC(=N)O
Synonyms:
  • (2Z)-2-(10-Oxophenanthren-9(10H)-ylidene)hydrazinecarboxamide
  • hydrazinecarboxamide, 2-(10-oxo-9(10H)-phenanthrenylidene)-, (2Z)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.