CAS 74379-74-1

1-(trimethylsilyl)cyclopropyl phenyl sulfide

Description:

1-(Trimethylsilyl)cyclopropyl phenyl sulfide is an organosilicon compound characterized by the presence of a trimethylsilyl group attached to a cyclopropyl ring, which is further connected to a phenyl group through a sulfur atom. This compound typically exhibits properties associated with both organosilicon and sulfur-containing compounds, such as moderate volatility and potential reactivity due to the presence of the sulfur atom. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, while the cyclopropyl moiety can impart unique steric and electronic properties. The phenyl group contributes to the overall hydrophobic character and can influence the compound's interactions in various chemical environments. Additionally, the presence of sulfur may allow for specific reactivity patterns, such as nucleophilic substitution or oxidation reactions. Overall, 1-(trimethylsilyl)cyclopropyl phenyl sulfide is of interest in synthetic organic chemistry and may have applications in materials science or as an intermediate in the synthesis of more complex molecules.

Formula: C₁₂H₁₈SSi

InChI: InChI=1/C12H18SSi/c1-14(2,3)12(9-10-12)13-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3

SMILES: C[Si](C)(C)C1(CC1)Sc1ccccc1

Synonyms:

• Trimethyl[1-(Phenylsulfanyl)Cyclopropyl]Silane