CAS 7438-05-3
:1-azidooctane
Description:
1-Azidooctane is an organic compound characterized by the presence of an azide functional group (-N3) attached to an octane chain, making it a member of the azidoalkane family. It is a colorless to pale yellow liquid at room temperature and is known for its high reactivity, particularly due to the azide group, which can undergo decomposition and lead to the release of nitrogen gas. This compound is typically used in organic synthesis and as a precursor in the preparation of other nitrogen-containing compounds. Its molecular structure contributes to its properties, including moderate volatility and solubility in organic solvents. However, 1-azidooctane is also considered hazardous due to its potential for explosive decomposition under certain conditions, necessitating careful handling and storage. As with many azides, it may pose risks of toxicity and environmental impact, emphasizing the importance of adhering to safety protocols when working with this substance in laboratory or industrial settings.
Formula:C8H17N3
InChI:InChI=1/C8H17N3/c1-2-3-4-5-6-7-8-10-11-9/h2-8H2,1H3
SMILES:CCCCCCCCN=[N+]=[NH-]
Synonyms:- Octane, 1-Azido-
- Octyl azide
- 1-Azidooctane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.