CAS 74380-71-5
:3-propanoylbenzoic acid
Description:
3-Propanoylbenzoic acid, also known by its IUPAC name, is an aromatic carboxylic acid characterized by the presence of both a benzoic acid moiety and a propanoyl group. This compound features a benzene ring substituted with a carboxylic acid (-COOH) and a propanoyl group (-C(=O)CH2CH3) at the meta position relative to the carboxylic acid. It is typically a white to off-white solid at room temperature and is soluble in organic solvents, though its solubility in water is limited due to the hydrophobic nature of the aromatic ring. The presence of both functional groups allows for potential reactivity in various organic reactions, including acylation and esterification. 3-Propanoylbenzoic acid may also exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its CAS number, 74380-71-5, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases.
Formula:C10H10O3
InChI:InChI=1/C10H10O3/c1-2-9(11)7-4-3-5-8(6-7)10(12)13/h3-6H,2H2,1H3,(H,12,13)
SMILES:CCC(=O)c1cccc(c1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.