CAS 74381-53-6: Leuprolide acetate
Description:Leuprolide acetate is a synthetic peptide analog of gonadotropin-releasing hormone (GnRH) and is classified as a gonadotropin-releasing hormone agonist. It is primarily used in the treatment of hormone-sensitive conditions such as prostate cancer, endometriosis, and precocious puberty. The substance functions by initially stimulating the pituitary gland to release luteinizing hormone (LH) and follicle-stimulating hormone (FSH), leading to a temporary increase in sex hormone levels. However, with continuous administration, it downregulates GnRH receptors, resulting in decreased production of sex hormones. Leuprolide acetate is typically administered via injection and is known for its prolonged action due to its acetate formulation, which enhances its stability and bioavailability. The compound is characterized by its specific molecular structure, which includes a sequence of amino acids that contribute to its biological activity. Common side effects may include hot flashes, decreased libido, and mood changes, reflecting its impact on hormonal balance. Overall, leuprolide acetate is a crucial therapeutic agent in managing various hormone-dependent disorders.
Formula:C61H88N16O14
InChI:InChI=1/C59H84N16O12.C2H4O2/c1-6-63-57(86)48-14-10-22-75(48)58(87)41(13-9-21-64-59(60)61)68-51(80)42(23-32(2)3)69-52(81)43(24-33(4)5)70-53(82)44(25-34-15-17-37(77)18-16-34)71-56(85)47(30-76)74-54(83)45(26-35-28-65-39-12-8-7-11-38(35)39)72-55(84)46(27-36-29-62-31-66-36)73-50(79)40-19-20-49(78)67-40;1-2(3)4/h7-8,11-12,15-18,28-29,31-33,40-48,65,76-77H,6,9-10,13-14,19-27,30H2,1-5H3,(H,62,66)(H,63,86)(H,67,78)(H,68,80)(H,69,81)(H,70,82)(H,71,85)(H,72,84)(H,73,79)(H,74,83)(H4,60,61,64);1H3,(H,3,4)/t40-,41-,42-,43+,44-,45-,46-,47-,48-;/m0./s1
- Synonyms:
- 5-Oxo-L-prolil-L-histidil-L-tryptophil-L-seril-L-thyrozil-D-leucil-L-arginil-N-ethyl-L-prolinamide acetate
- Leuprorelin Acetate
- 5-oxoprolylhistidyltryptophylseryltyrosylleucylleucyl-N~5~-(diaminomethylidene)ornithyl-N-ethylprolinamide acetate (1:1)
- 5-oxo-L-prolyl-L-histidyl-L-tryptophyl-L-seryl-L-tyrosyl-D-leucyl-L-leucyl-N~5~-(diaminomethylidene)-L-ornithyl-N-ethyl-L-prolinamide acetate (1:1)