CAS 74385-17-4
:α,α-Diethyl-3-methoxybenzenemethanol
Description:
α,α-Diethyl-3-methoxybenzenemethanol, identified by its CAS number 74385-17-4, is an organic compound characterized by its structure, which includes a methoxy group and a diethyl substitution on a benzene ring. This compound typically exhibits properties associated with aromatic alcohols, such as moderate solubility in organic solvents and limited solubility in water due to its hydrophobic hydrocarbon chains. The presence of the methoxy group contributes to its electron-donating characteristics, potentially influencing its reactivity and interaction with other chemical species. Additionally, the diethyl groups can affect the steric hindrance around the hydroxyl group, which may impact its ability to participate in hydrogen bonding and other intermolecular interactions. This compound may be of interest in various applications, including organic synthesis and as a potential intermediate in the production of more complex chemical entities. However, specific physical and chemical properties such as boiling point, melting point, and reactivity would require further empirical data for precise characterization.
Formula:C12H18O2
InChI:InChI=1S/C12H18O2/c1-4-12(13,5-2)10-7-6-8-11(9-10)14-3/h6-9,13H,4-5H2,1-3H3
InChI key:InChIKey=ICGNXUBDOLCUKE-UHFFFAOYSA-N
SMILES:C(CC)(CC)(O)C1=CC(OC)=CC=C1
Synonyms:- Benzenemethanol, α,α-diethyl-3-methoxy-
- α,α-Diethyl-3-methoxybenzenemethanol
- 3-(3-METHOXYPHENYL)PENTAN-3-OL
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.